C16H18FN7OS — CID 70804039
1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]-1-methylurea (PubChem CID 70804039) has the molecular formula C16H18FN7OS and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]-1-methylurea.
| Compound Name | 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 70804039 |
| Molecular Formula | C16H18FN7OS |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]-1-methylurea |
| SMILES | CSc1nc(N)nc(N(C)N(C)C(=O)Nc2cccc(CF)c2)c1C#N |
| InChI | InChI=1S/C16H18FN7OS/c1-23(13-12(9-18)14(26-3)22-15(19)21-13)24(2)16(25)20-11-6-4-5-10(7-11)8-17/h4-7H,8H2,1-3H3,(H,20,25)(H2,19,21,22) |
| InChIKey | JVZMJZKRDFYSAQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|