C15H16FN7OS — CID 70804076
1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]urea (PubChem CID 70804076) has the molecular formula C15H16FN7OS and a molecular weight of 361.41 g/mol. Its IUPAC name is 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]urea.
| Compound Name | 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 70804076 |
| Molecular Formula | C15H16FN7OS |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-3-[3-(fluoromethyl)phenyl]urea |
| SMILES | CSc1nc(N)nc(N(C)NC(=O)Nc2cccc(CF)c2)c1C#N |
| InChI | InChI=1S/C15H16FN7OS/c1-23(12-11(8-17)13(25-2)21-14(18)20-12)22-15(24)19-10-5-3-4-9(6-10)7-16/h3-6H,7H2,1-2H3,(H2,18,20,21)(H2,19,22,24) |
| InChIKey | XHCQKWBIJBHOBJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|