C20H26F3N7OS — CID 160628786
(2R)-6-amino-2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]hexanamide;methane (PubChem CID 160628786) has the molecular formula C20H26F3N7OS and a molecular weight of 469.54 g/mol. Its IUPAC name is (2R)-6-amino-2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]hexanamide;methane.
| Compound Name | (2R)-6-amino-2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]hexanamide;methane |
|---|---|
| PubChem CID | 160628786 |
| Molecular Formula | C20H26F3N7OS |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (2R)-6-amino-2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]hexanamide;methane |
| SMILES | C.CSc1nc(N)nc(N[C@H](CCCCN)C(=O)Nc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C19H22F3N7OS.CH4/c1-31-17-13(10-24)15(28-18(25)29-17)27-14(7-2-3-8-23)16(30)26-12-6-4-5-11(9-12)19(20,21)22;/h4-6,9,14H,2-3,7-8,23H2,1H3,(H,26,30)(H3,25,27,28,29);1H4/t14-;/m1./s1 |
| InChIKey | RHQPGMIOCFTILM-PFEQFJNWSA-N |
| XLogP | 3.86 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|