C19H20F3N7O2S — CID 143041859
(2S)-5-acetamido-2-[(2-amino-5-cyano-4-sulfanylidene-1H-pyrimidin-6-yl)amino]-N-[3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 143041859) has the molecular formula C19H20F3N7O2S and a molecular weight of 467.48 g/mol. Its IUPAC name is (2S)-5-acetamido-2-[(2-amino-5-cyano-4-sulfanylidene-1H-pyrimidin-6-yl)amino]-N-[3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | (2S)-5-acetamido-2-[(2-amino-5-cyano-4-sulfanylidene-1H-pyrimidin-6-yl)amino]-N-[3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 143041859 |
| Molecular Formula | C19H20F3N7O2S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (2S)-5-acetamido-2-[(2-amino-5-cyano-4-sulfanylidene-1H-pyrimidin-6-yl)amino]-N-[3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | CC(=O)NCCC[C@H](Nc1[nH]c(N)nc(=S)c1C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N7O2S/c1-10(30)25-7-3-6-14(27-15-13(9-23)17(32)29-18(24)28-15)16(31)26-12-5-2-4-11(8-12)19(20,21)22/h2,4-5,8,14H,3,6-7H2,1H3,(H,25,30)(H,26,31)(H4,24,27,28,29,32)/t14-/m0/s1 |
| InChIKey | TURGNGYVDFYQOT-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|