C13H9F3N4S — CID 82070684
2-amino-4-sulfanylidene-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 82070684) has the molecular formula C13H9F3N4S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-amino-4-sulfanylidene-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-sulfanylidene-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 82070684 |
| Molecular Formula | C13H9F3N4S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-amino-4-sulfanylidene-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(Cc2cccc(C(F)(F)F)c2)[nH]c(N)nc1=S |
| InChI | InChI=1S/C13H9F3N4S/c14-13(15,16)8-3-1-2-7(4-8)5-10-9(6-17)11(21)20-12(18)19-10/h1-4H,5H2,(H3,18,19,20,21) |
| InChIKey | RVHOKLKMZREQLM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|