C17H15F3N4O2 — CID 11653462
N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 11653462) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11653462 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1nc(NC(=O)Cc2cccc(C(F)(F)F)c2)cc(N)c1C#N |
| InChI | InChI=1S/C17H15F3N4O2/c1-2-26-16-12(9-21)13(22)8-14(24-16)23-15(25)7-10-4-3-5-11(6-10)17(18,19)20/h3-6,8H,2,7H2,1H3,(H3,22,23,24,25) |
| InChIKey | QBKOAYHHONWIAL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |