C16H15ClN4O2 — CID 11544489
N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(4-chlorophenyl)acetamide (PubChem CID 11544489) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 11544489 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(4-chlorophenyl)acetamide |
| SMILES | CCOc1nc(NC(=O)Cc2ccc(Cl)cc2)cc(N)c1C#N |
| InChI | InChI=1S/C16H15ClN4O2/c1-2-23-16-12(9-18)13(19)8-14(21-16)20-15(22)7-10-3-5-11(17)6-4-10/h3-6,8H,2,7H2,1H3,(H3,19,20,21,22) |
| InChIKey | CLCSSDBGIADDIH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |