C17H17FN4O3 — CID 66920814
4-amino-5-cyano-6-ethoxy-N-[(4-fluoro-3-methoxyphenyl)methyl]pyridine-2-carboxamide (PubChem CID 66920814) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-amino-5-cyano-6-ethoxy-N-[(4-fluoro-3-methoxyphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-5-cyano-6-ethoxy-N-[(4-fluoro-3-methoxyphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66920814 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-amino-5-cyano-6-ethoxy-N-[(4-fluoro-3-methoxyphenyl)methyl]pyridine-2-carboxamide |
| SMILES | CCOc1nc(C(=O)NCc2ccc(F)c(OC)c2)cc(N)c1C#N |
| InChI | InChI=1S/C17H17FN4O3/c1-3-25-17-11(8-19)13(20)7-14(22-17)16(23)21-9-10-4-5-12(18)15(6-10)24-2/h4-7H,3,9H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | IJWNPEGVERJBFK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |