C18H16N6O2S — CID 66920638
4-amino-5-cyano-6-ethoxy-N-[[4-(thiadiazol-5-yl)phenyl]methyl]pyridine-2-carboxamide (PubChem CID 66920638) has the molecular formula C18H16N6O2S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-amino-5-cyano-6-ethoxy-N-[[4-(thiadiazol-5-yl)phenyl]methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-5-cyano-6-ethoxy-N-[[4-(thiadiazol-5-yl)phenyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66920638 |
| Molecular Formula | C18H16N6O2S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-amino-5-cyano-6-ethoxy-N-[[4-(thiadiazol-5-yl)phenyl]methyl]pyridine-2-carboxamide |
| SMILES | CCOc1nc(C(=O)NCc2ccc(-c3cnns3)cc2)cc(N)c1C#N |
| InChI | InChI=1S/C18H16N6O2S/c1-2-26-18-13(8-19)14(20)7-15(23-18)17(25)21-9-11-3-5-12(6-4-11)16-10-22-24-27-16/h3-7,10H,2,9H2,1H3,(H2,20,23)(H,21,25) |
| InChIKey | QWGWGNWKYSRTIU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |