C16H15N5O4 — CID 11522966
4-amino-5-cyano-6-ethoxy-N-[(4-nitrophenyl)methyl]pyridine-2-carboxamide (PubChem CID 11522966) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-amino-5-cyano-6-ethoxy-N-[(4-nitrophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-5-cyano-6-ethoxy-N-[(4-nitrophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11522966 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-amino-5-cyano-6-ethoxy-N-[(4-nitrophenyl)methyl]pyridine-2-carboxamide |
| SMILES | CCOc1nc(C(=O)NCc2ccc([N+](=O)[O-])cc2)cc(N)c1C#N |
| InChI | InChI=1S/C16H15N5O4/c1-2-25-16-12(8-17)13(18)7-14(20-16)15(22)19-9-10-3-5-11(6-4-10)21(23)24/h3-7H,2,9H2,1H3,(H2,18,20)(H,19,22) |
| InChIKey | LUOTVHITZOCKRW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|