C20H15ClN4O3S — CID 87205338
4-amino-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-chloro-5-cyanopyridine-2-carboxamide (PubChem CID 87205338) has the molecular formula C20H15ClN4O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is 4-amino-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-chloro-5-cyanopyridine-2-carboxamide.
| Compound Name | 4-amino-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-chloro-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 87205338 |
| Molecular Formula | C20H15ClN4O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-amino-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-chloro-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1c(N)cc(C(=O)NCc2ccc(S(=O)(=O)c3ccccc3)cc2)nc1Cl |
| InChI | InChI=1S/C20H15ClN4O3S/c21-19-16(11-22)17(23)10-18(25-19)20(26)24-12-13-6-8-15(9-7-13)29(27,28)14-4-2-1-3-5-14/h1-10H,12H2,(H2,23,25)(H,24,26) |
| InChIKey | VMBSXUUSHJXTFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|