C20H23N5O3 — CID 66920795
4-amino-5-cyano-6-ethoxy-N-[(4-morpholin-4-ylphenyl)methyl]pyridine-2-carboxamide (PubChem CID 66920795) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-amino-5-cyano-6-ethoxy-N-[(4-morpholin-4-ylphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-5-cyano-6-ethoxy-N-[(4-morpholin-4-ylphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66920795 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-amino-5-cyano-6-ethoxy-N-[(4-morpholin-4-ylphenyl)methyl]pyridine-2-carboxamide |
| SMILES | CCOc1nc(C(=O)NCc2ccc(N3CCOCC3)cc2)cc(N)c1C#N |
| InChI | InChI=1S/C20H23N5O3/c1-2-28-20-16(12-21)17(22)11-18(24-20)19(26)23-13-14-3-5-15(6-4-14)25-7-9-27-10-8-25/h3-6,11H,2,7-10,13H2,1H3,(H2,22,24)(H,23,26) |
| InChIKey | UGDNZUHLCLVQBC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|