C16H18N4O2 — CID 70924868
4-amino-2-ethoxy-6-[(4-methoxyphenyl)methylamino]pyridine-3-carbonitrile (PubChem CID 70924868) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-amino-2-ethoxy-6-[(4-methoxyphenyl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 4-amino-2-ethoxy-6-[(4-methoxyphenyl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 70924868 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-amino-2-ethoxy-6-[(4-methoxyphenyl)methylamino]pyridine-3-carbonitrile |
| SMILES | CCOc1nc(NCc2ccc(OC)cc2)cc(N)c1C#N |
| InChI | InChI=1S/C16H18N4O2/c1-3-22-16-13(9-17)14(18)8-15(20-16)19-10-11-4-6-12(21-2)7-5-11/h4-8H,3,10H2,1-2H3,(H3,18,19,20) |
| InChIKey | SURWQXHKNHQCMR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |