C15H19N3O2 — CID 61028652
6-ethoxy-2-N-[(3-methoxyphenyl)methyl]pyridine-2,5-diamine (PubChem CID 61028652) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-ethoxy-2-N-[(3-methoxyphenyl)methyl]pyridine-2,5-diamine.
| Compound Name | 6-ethoxy-2-N-[(3-methoxyphenyl)methyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 61028652 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 6-ethoxy-2-N-[(3-methoxyphenyl)methyl]pyridine-2,5-diamine |
| SMILES | CCOc1nc(NCc2cccc(OC)c2)ccc1N |
| InChI | InChI=1S/C15H19N3O2/c1-3-20-15-13(16)7-8-14(18-15)17-10-11-5-4-6-12(9-11)19-2/h4-9H,3,10,16H2,1-2H3,(H,17,18) |
| InChIKey | VPRCOJVUAGTOHF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |