C14H17N3O — CID 80647155
6-N-[(3-ethoxyphenyl)methyl]pyridine-2,6-diamine (PubChem CID 80647155) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-N-[(3-ethoxyphenyl)methyl]pyridine-2,6-diamine.
| Compound Name | 6-N-[(3-ethoxyphenyl)methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647155 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 6-N-[(3-ethoxyphenyl)methyl]pyridine-2,6-diamine |
| SMILES | CCOc1cccc(CNc2cccc(N)n2)c1 |
| InChI | InChI=1S/C14H17N3O/c1-2-18-12-6-3-5-11(9-12)10-16-14-8-4-7-13(15)17-14/h3-9H,2,10H2,1H3,(H3,15,16,17) |
| InChIKey | GMDAUFUAYXDWNB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |