C13H16N4O — CID 115612215
4-N-[(3-ethoxyphenyl)methyl]pyrimidine-4,6-diamine (PubChem CID 115612215) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-N-[(3-ethoxyphenyl)methyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[(3-ethoxyphenyl)methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115612215 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-N-[(3-ethoxyphenyl)methyl]pyrimidine-4,6-diamine |
| SMILES | CCOc1cccc(CNc2cc(N)ncn2)c1 |
| InChI | InChI=1S/C13H16N4O/c1-2-18-11-5-3-4-10(6-11)8-15-13-7-12(14)16-9-17-13/h3-7,9H,2,8H2,1H3,(H3,14,15,16,17) |
| InChIKey | RJJGSKODAHBZPM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |