C16H19ClN2O3 — CID 21154135
N-(2-amino-5-chlorophenyl)-2-(4-ethoxyphenyl)acetamide;hydrate (PubChem CID 21154135) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-(4-ethoxyphenyl)acetamide;hydrate.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-(4-ethoxyphenyl)acetamide;hydrate |
|---|---|
| PubChem CID | 21154135 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-(4-ethoxyphenyl)acetamide;hydrate |
| SMILES | CCOc1ccc(CC(=O)Nc2cc(Cl)ccc2N)cc1.O |
| InChI | InChI=1S/C16H17ClN2O2.H2O/c1-2-21-13-6-3-11(4-7-13)9-16(20)19-15-10-12(17)5-8-14(15)18;/h3-8,10H,2,9,18H2,1H3,(H,19,20);1H2 |
| InChIKey | VNGXOSIGNSMYKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|