C16H14Br2N4O2 — CID 11705144
N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(2,5-dibromophenyl)acetamide (PubChem CID 11705144) has the molecular formula C16H14Br2N4O2 and a molecular weight of 454.12 g/mol. Its IUPAC name is N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(2,5-dibromophenyl)acetamide.
| Compound Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(2,5-dibromophenyl)acetamide |
|---|---|
| PubChem CID | 11705144 |
| Molecular Formula | C16H14Br2N4O2 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | N-(4-amino-5-cyano-6-ethoxy-2-pyridinyl)-2-(2,5-dibromophenyl)acetamide |
| SMILES | CCOc1nc(NC(=O)Cc2cc(Br)ccc2Br)cc(N)c1C#N |
| InChI | InChI=1S/C16H14Br2N4O2/c1-2-24-16-11(8-19)13(20)7-14(22-16)21-15(23)6-9-5-10(17)3-4-12(9)18/h3-5,7H,2,6H2,1H3,(H3,20,21,22,23) |
| InChIKey | JNCRDJFWGNSROM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |