C18H20F3N5O — CID 8840552
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 8840552) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8840552 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#Cc1c(N)n[nH]c1CCCCCNC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N5O/c19-18(20,21)13-6-4-5-12(9-13)10-16(27)24-8-3-1-2-7-15-14(11-22)17(23)26-25-15/h4-6,9H,1-3,7-8,10H2,(H,24,27)(H3,23,25,26) |
| InChIKey | ZENLRHADTVQWSM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|