C20H24F3N3O2 — CID 19797607
2-[3-amino-4-(2-aminoethoxy)phenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide (PubChem CID 19797607) has the molecular formula C20H24F3N3O2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[3-amino-4-(2-aminoethoxy)phenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide.
| Compound Name | 2-[3-amino-4-(2-aminoethoxy)phenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 19797607 |
| Molecular Formula | C20H24F3N3O2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[3-amino-4-(2-aminoethoxy)phenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide |
| SMILES | NCCOc1ccc(CC(=O)NCCCc2cccc(C(F)(F)F)c2)cc1N |
| InChI | InChI=1S/C20H24F3N3O2/c21-20(22,23)16-5-1-3-14(11-16)4-2-9-26-19(27)13-15-6-7-18(17(25)12-15)28-10-8-24/h1,3,5-7,11-12H,2,4,8-10,13,24-25H2,(H,26,27) |
| InChIKey | PVROKUSBPQZKOB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|