C21H23F3N4O3 — CID 152644053
2-[4-(2-azidoethoxy)-3-methoxyphenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide (PubChem CID 152644053) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[4-(2-azidoethoxy)-3-methoxyphenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide.
| Compound Name | 2-[4-(2-azidoethoxy)-3-methoxyphenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 152644053 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[4-(2-azidoethoxy)-3-methoxyphenyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]acetamide |
| SMILES | COc1cc(CC(=O)NCCCc2cccc(C(F)(F)F)c2)ccc1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C21H23F3N4O3/c1-30-19-13-16(7-8-18(19)31-11-10-27-28-25)14-20(29)26-9-3-5-15-4-2-6-17(12-15)21(22,23)24/h2,4,6-8,12-13H,3,5,9-11,14H2,1H3,(H,26,29) |
| InChIKey | ZGEFXGAYNMAHND-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|