C25H32N4O5 — CID 91156304
[(2R)-2-[[2-[4-(2-azidoethoxy)-3-methoxyphenyl]acetyl]amino]-1-phenylpropan-2-yl] 2,2-dimethylpropanoate (PubChem CID 91156304) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is [(2R)-2-[[2-[4-(2-azidoethoxy)-3-methoxyphenyl]acetyl]amino]-1-phenylpropan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[[2-[4-(2-azidoethoxy)-3-methoxyphenyl]acetyl]amino]-1-phenylpropan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91156304 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [(2R)-2-[[2-[4-(2-azidoethoxy)-3-methoxyphenyl]acetyl]amino]-1-phenylpropan-2-yl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CC(=O)N[C@@](C)(Cc2ccccc2)OC(=O)C(C)(C)C)ccc1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C25H32N4O5/c1-24(2,3)23(31)34-25(4,17-18-9-7-6-8-10-18)28-22(30)16-19-11-12-20(21(15-19)32-5)33-14-13-27-29-26/h6-12,15H,13-14,16-17H2,1-5H3,(H,28,30)/t25-/m1/s1 |
| InChIKey | ZPZSKXKAVLHGSW-RUZDIDTESA-N |
| XLogP | 4.59 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|