C13H17N3O3 — CID 101457350
[4-(azidomethyl)-2-methoxyphenyl] 2,2-dimethylpropanoate (PubChem CID 101457350) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [4-(azidomethyl)-2-methoxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(azidomethyl)-2-methoxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101457350 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [4-(azidomethyl)-2-methoxyphenyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CN=[N+]=[N-])ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H17N3O3/c1-13(2,3)12(17)19-10-6-5-9(8-15-16-14)7-11(10)18-4/h5-7H,8H2,1-4H3 |
| InChIKey | CXAQDFIQYPYKND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|