C13H16N4O3 — CID 54573821
[2-methoxy-4-(2H-tetrazol-5-yl)phenyl] 2,2-dimethylpropanoate (PubChem CID 54573821) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is [2-methoxy-4-(2H-tetrazol-5-yl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-methoxy-4-(2H-tetrazol-5-yl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54573821 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [2-methoxy-4-(2H-tetrazol-5-yl)phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(-c2nn[nH]n2)ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H16N4O3/c1-13(2,3)12(18)20-9-6-5-8(7-10(9)19-4)11-14-16-17-15-11/h5-7H,1-4H3,(H,14,15,16,17) |
| InChIKey | ZZEGSFVSTZHHEI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|