C16H15N5O3 — CID 17164751
2,3-dimethoxy-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 17164751) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17164751 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2,3-dimethoxy-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(-c3nn[nH]n3)c2)c1OC |
| InChI | InChI=1S/C16H15N5O3/c1-23-13-8-4-7-12(14(13)24-2)16(22)17-11-6-3-5-10(9-11)15-18-20-21-19-15/h3-9H,1-2H3,(H,17,22)(H,18,19,20,21) |
| InChIKey | BLDGGQOFEHUIEH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |