C15H10F3N5O — CID 9404095
N-[3-(2H-tetrazol-5-yl)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 9404095) has the molecular formula C15H10F3N5O and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[3-(2H-tetrazol-5-yl)phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2H-tetrazol-5-yl)phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 9404095 |
| Molecular Formula | C15H10F3N5O |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[3-(2H-tetrazol-5-yl)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F3N5O/c16-15(17,18)11-6-4-9(5-7-11)14(24)19-12-3-1-2-10(8-12)13-20-22-23-21-13/h1-8H,(H,19,24)(H,20,21,22,23) |
| InChIKey | RIKVNXRNJHFVKJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |