C14H20N6O — CID 115431915
2-(aminomethyl)-2-ethyl-N-[3-(2H-tetrazol-5-yl)phenyl]butanamide (PubChem CID 115431915) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(aminomethyl)-2-ethyl-N-[3-(2H-tetrazol-5-yl)phenyl]butanamide.
| Compound Name | 2-(aminomethyl)-2-ethyl-N-[3-(2H-tetrazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 115431915 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-(aminomethyl)-2-ethyl-N-[3-(2H-tetrazol-5-yl)phenyl]butanamide |
| SMILES | CCC(CC)(CN)C(=O)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C14H20N6O/c1-3-14(4-2,9-15)13(21)16-11-7-5-6-10(8-11)12-17-19-20-18-12/h5-8H,3-4,9,15H2,1-2H3,(H,16,21)(H,17,18,19,20) |
| InChIKey | OHEUTRIDZSDOSL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |