C10H11N5O2 — CID 17164270
ethyl N-[3-(2H-tetrazol-5-yl)phenyl]carbamate (PubChem CID 17164270) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is ethyl N-[3-(2H-tetrazol-5-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(2H-tetrazol-5-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 17164270 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | ethyl N-[3-(2H-tetrazol-5-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H11N5O2/c1-2-17-10(16)11-8-5-3-4-7(6-8)9-12-14-15-13-9/h3-6H,2H2,1H3,(H,11,16)(H,12,13,14,15) |
| InChIKey | DWQNCICSKIOVTJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |