C11H14N6O — CID 62639485
2-(methylamino)-N-[3-(2H-tetrazol-5-yl)phenyl]propanamide (PubChem CID 62639485) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(methylamino)-N-[3-(2H-tetrazol-5-yl)phenyl]propanamide.
| Compound Name | 2-(methylamino)-N-[3-(2H-tetrazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 62639485 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-(methylamino)-N-[3-(2H-tetrazol-5-yl)phenyl]propanamide |
| SMILES | CNC(C)C(=O)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C11H14N6O/c1-7(12-2)11(18)13-9-5-3-4-8(6-9)10-14-16-17-15-10/h3-7,12H,1-2H3,(H,13,18)(H,14,15,16,17) |
| InChIKey | KRQINVPQXNVGFL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |