C14H10N6O3 — CID 17163937
3-nitro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 17163937) has the molecular formula C14H10N6O3 and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-nitro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 3-nitro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17163937 |
| Molecular Formula | C14H10N6O3 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-nitro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N6O3/c21-14(10-4-2-6-12(8-10)20(22)23)15-11-5-1-3-9(7-11)13-16-18-19-17-13/h1-8H,(H,15,21)(H,16,17,18,19) |
| InChIKey | FWGZIKAQBRJPNC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|