C19H16N8O — CID 166211148
3-[(pyrimidin-4-ylamino)methyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 166211148) has the molecular formula C19H16N8O and a molecular weight of 372.39 g/mol. Its IUPAC name is 3-[(pyrimidin-4-ylamino)methyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 3-[(pyrimidin-4-ylamino)methyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 166211148 |
| Molecular Formula | C19H16N8O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-[(pyrimidin-4-ylamino)methyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1cccc(CNc2ccncn2)c1 |
| InChI | InChI=1S/C19H16N8O/c28-19(23-16-6-2-4-14(10-16)18-24-26-27-25-18)15-5-1-3-13(9-15)11-21-17-7-8-20-12-22-17/h1-10,12H,11H2,(H,23,28)(H,20,21,22)(H,24,25,26,27) |
| InChIKey | HQXSESRLXZOJRW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |