C14H9ClFN5O — CID 17165094
2-chloro-6-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 17165094) has the molecular formula C14H9ClFN5O and a molecular weight of 317.71 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17165094 |
| Molecular Formula | C14H9ClFN5O |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-chloro-6-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H9ClFN5O/c15-10-5-2-6-11(16)12(10)14(22)17-9-4-1-3-8(7-9)13-18-20-21-19-13/h1-7H,(H,17,22)(H,18,19,20,21) |
| InChIKey | PPEKARWSBHKAJC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |