C15H15N5O3S — CID 110720262
2-methoxy-5-methyl-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 110720262) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110720262 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-methoxy-5-methyl-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C15H15N5O3S/c1-10-3-8-13(23-2)14(9-10)24(21,22)18-12-6-4-11(5-7-12)15-16-19-20-17-15/h3-9,18H,1-2H3,(H,16,17,19,20) |
| InChIKey | OQVFGHXXAYBAEY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |