C9H11N5O2S — CID 110720243
N-[4-(2H-tetrazol-5-yl)phenyl]ethanesulfonamide (PubChem CID 110720243) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is N-[4-(2H-tetrazol-5-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2H-tetrazol-5-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110720243 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-[4-(2H-tetrazol-5-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C9H11N5O2S/c1-2-17(15,16)12-8-5-3-7(4-6-8)9-10-13-14-11-9/h3-6,12H,2H2,1H3,(H,10,11,13,14) |
| InChIKey | LQJWFEJKPSKNAP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |