C13H9Cl2N5O2S — CID 78843376
3,5-dichloro-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 78843376) has the molecular formula C13H9Cl2N5O2S and a molecular weight of 370.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 78843376 |
| Molecular Formula | C13H9Cl2N5O2S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 3,5-dichloro-N-[4-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2nn[nH]n2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2N5O2S/c14-9-5-10(15)7-12(6-9)23(21,22)18-11-3-1-8(2-4-11)13-16-19-20-17-13/h1-7,18H,(H,16,17,19,20) |
| InChIKey | CARWRAGCNLTDKS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |