C15H15N5O2S — CID 46830882
4-methyl-N-[2-methyl-5-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 46830882) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-5-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-methyl-5-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46830882 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-methyl-N-[2-methyl-5-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(-c3nn[nH]n3)ccc2C)cc1 |
| InChI | InChI=1S/C15H15N5O2S/c1-10-3-7-13(8-4-10)23(21,22)18-14-9-12(6-5-11(14)2)15-16-19-20-17-15/h3-9,18H,1-2H3,(H,16,17,19,20) |
| InChIKey | MBXJTOSWHOQOKY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |