C13H10FN5O2S — CID 8823430
4-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 8823430) has the molecular formula C13H10FN5O2S and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8823430 |
| Molecular Formula | C13H10FN5O2S |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-fluoro-N-[3-(2H-tetrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2nn[nH]n2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10FN5O2S/c14-10-4-6-12(7-5-10)22(20,21)17-11-3-1-2-9(8-11)13-15-18-19-16-13/h1-8,17H,(H,15,16,18,19) |
| InChIKey | NTELIKWYXYZCNQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |