C17H15N5O2S2 — CID 56941162
3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 56941162) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56941162 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1ccc2sc(S(=O)(=O)Nc3cccc(-c4nn[nH]n4)c3)c(C)c2c1 |
| InChI | InChI=1S/C17H15N5O2S2/c1-10-6-7-15-14(8-10)11(2)17(25-15)26(23,24)20-13-5-3-4-12(9-13)16-18-21-22-19-16/h3-9,20H,1-2H3,(H,18,19,21,22) |
| InChIKey | XERICNKIDOUEQL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |