C14H19NO2S2 — CID 143182513
N-butyl-3,5-dimethyl-1-benzothiophene-2-sulfonamide (PubChem CID 143182513) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is N-butyl-3,5-dimethyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-butyl-3,5-dimethyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143182513 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-butyl-3,5-dimethyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1sc2ccc(C)cc2c1C |
| InChI | InChI=1S/C14H19NO2S2/c1-4-5-8-15-19(16,17)14-11(3)12-9-10(2)6-7-13(12)18-14/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | XUIONPRPZARMLX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|