C10H10ClNO2S2 — CID 23548743
5-chloro-N,3-dimethyl-1-benzothiophene-2-sulfonamide (PubChem CID 23548743) has the molecular formula C10H10ClNO2S2 and a molecular weight of 275.78 g/mol. Its IUPAC name is 5-chloro-N,3-dimethyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N,3-dimethyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23548743 |
| Molecular Formula | C10H10ClNO2S2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5-chloro-N,3-dimethyl-1-benzothiophene-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1sc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C10H10ClNO2S2/c1-6-8-5-7(11)3-4-9(8)15-10(6)16(13,14)12-2/h3-5,12H,1-2H3 |
| InChIKey | CFYZXGYDEFTCFJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |