C10H8Cl2O2S2 — CID 11266391
5-chloro-2-(chloromethylsulfonyl)-3-methyl-1-benzothiophene (PubChem CID 11266391) has the molecular formula C10H8Cl2O2S2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 5-chloro-2-(chloromethylsulfonyl)-3-methyl-1-benzothiophene.
| Compound Name | 5-chloro-2-(chloromethylsulfonyl)-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 11266391 |
| Molecular Formula | C10H8Cl2O2S2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | 5-chloro-2-(chloromethylsulfonyl)-3-methyl-1-benzothiophene |
| SMILES | Cc1c(S(=O)(=O)CCl)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H8Cl2O2S2/c1-6-8-4-7(12)2-3-9(8)15-10(6)16(13,14)5-11/h2-4H,5H2,1H3 |
| InChIKey | QYEPQONSANZYTH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|