C15H20ClNO3S2 — CID 58713277
5-chloro-N-(2-hydroxypropyl)-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide (PubChem CID 58713277) has the molecular formula C15H20ClNO3S2 and a molecular weight of 361.92 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxypropyl)-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2-hydroxypropyl)-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58713277 |
| Molecular Formula | C15H20ClNO3S2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 5-chloro-N-(2-hydroxypropyl)-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCN(CC(C)O)S(=O)(=O)c1sc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C15H20ClNO3S2/c1-4-7-17(9-10(2)18)22(19,20)15-11(3)13-8-12(16)5-6-14(13)21-15/h5-6,8,10,18H,4,7,9H2,1-3H3 |
| InChIKey | NDCFAHGEERSNPL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |