C16H21BrClNO2S2 — CID 58713396
N-(2-bromobutyl)-5-chloro-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide (PubChem CID 58713396) has the molecular formula C16H21BrClNO2S2 and a molecular weight of 438.84 g/mol. Its IUPAC name is N-(2-bromobutyl)-5-chloro-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-(2-bromobutyl)-5-chloro-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58713396 |
| Molecular Formula | C16H21BrClNO2S2 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N-(2-bromobutyl)-5-chloro-3-methyl-N-propyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCN(CC(Br)CC)S(=O)(=O)c1sc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C16H21BrClNO2S2/c1-4-8-19(10-12(17)5-2)23(20,21)16-11(3)14-9-13(18)6-7-15(14)22-16/h6-7,9,12H,4-5,8,10H2,1-3H3 |
| InChIKey | ABHFPWRZJYMGSY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|