C14H18ClNO3S2 — CID 141094629
3-chloro-N-(2-hydroxypropyl)-N-propyl-1-benzothiophene-2-sulfonamide (PubChem CID 141094629) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxypropyl)-N-propyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 3-chloro-N-(2-hydroxypropyl)-N-propyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 141094629 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-chloro-N-(2-hydroxypropyl)-N-propyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCN(CC(C)O)S(=O)(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C14H18ClNO3S2/c1-3-8-16(9-10(2)17)21(18,19)14-13(15)11-6-4-5-7-12(11)20-14/h4-7,10,17H,3,8-9H2,1-2H3 |
| InChIKey | NBXHQEGWQONWKJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |