C12H19NO3S — CID 59164206
N-[(2S)-2-hydroxypropyl]-N-propylbenzenesulfonamide (PubChem CID 59164206) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-N-propylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 59164206 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-N-propylbenzenesulfonamide |
| SMILES | CCCN(C[C@H](C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S/c1-3-9-13(10-11(2)14)17(15,16)12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | CJMKUKBXMGHNOE-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |