C12H21Cl2NO2S — CID 142038428
N,N-dipropylbenzenesulfonamide;dihydrochloride (PubChem CID 142038428) has the molecular formula C12H21Cl2NO2S and a molecular weight of 314.28 g/mol. Its IUPAC name is N,N-dipropylbenzenesulfonamide;dihydrochloride.
| Compound Name | N,N-dipropylbenzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 142038428 |
| Molecular Formula | C12H21Cl2NO2S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N,N-dipropylbenzenesulfonamide;dihydrochloride |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C12H19NO2S.2ClH/c1-3-10-13(11-4-2)16(14,15)12-8-6-5-7-9-12;;/h5-9H,3-4,10-11H2,1-2H3;2*1H |
| InChIKey | CUHMFEUFYJVXMP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |