C21H27NO4S — CID 70464418
4-(dipropylsulfamoyl)benzoic acid;styrene (PubChem CID 70464418) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)benzoic acid;styrene.
| Compound Name | 4-(dipropylsulfamoyl)benzoic acid;styrene |
|---|---|
| PubChem CID | 70464418 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-(dipropylsulfamoyl)benzoic acid;styrene |
| SMILES | C=Cc1ccccc1.CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO4S.C8H8/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16;1-2-8-6-4-3-5-7-8/h5-8H,3-4,9-10H2,1-2H3,(H,15,16);2-7H,1H2 |
| InChIKey | UMHGJBLTDZSKNR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |