C20H25NO5S — CID 146382115
benzaldehyde;4-(dipropylsulfamoyl)benzoic acid (PubChem CID 146382115) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is benzaldehyde;4-(dipropylsulfamoyl)benzoic acid.
| Compound Name | benzaldehyde;4-(dipropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 146382115 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | benzaldehyde;4-(dipropylsulfamoyl)benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO4S.C7H6O/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16;8-6-7-4-2-1-3-5-7/h5-8H,3-4,9-10H2,1-2H3,(H,15,16);1-6H |
| InChIKey | AJMHQEAWBXRYRY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|