C21H26N2O5S — CID 11316067
2-[[2-[4-(dipropylsulfamoyl)phenyl]-2-oxoethyl]amino]benzoic acid (PubChem CID 11316067) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[[2-[4-(dipropylsulfamoyl)phenyl]-2-oxoethyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-(dipropylsulfamoyl)phenyl]-2-oxoethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11316067 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[[2-[4-(dipropylsulfamoyl)phenyl]-2-oxoethyl]amino]benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)CNc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-3-13-23(14-4-2)29(27,28)17-11-9-16(10-12-17)20(24)15-22-19-8-6-5-7-18(19)21(25)26/h5-12,22H,3-4,13-15H2,1-2H3,(H,25,26) |
| InChIKey | KBUKVXQJOXULGM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |