C26H28N2O4S — CID 139187519
acridine;4-(dipropylsulfamoyl)benzoic acid (PubChem CID 139187519) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is acridine;4-(dipropylsulfamoyl)benzoic acid.
| Compound Name | acridine;4-(dipropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 139187519 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | acridine;4-(dipropylsulfamoyl)benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H19NO4S.C13H9N/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h5-8H,3-4,9-10H2,1-2H3,(H,15,16);1-9H |
| InChIKey | FOKKTGVFULMYSO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|